Products 2082663-46-3
CAS 2082663-46-3 appears in our catalog under these names: 4–(1，1–difluoro–2–hydroxyethyl)benzonitrile, 4-(1，1-difluoro-2-hydroxyethyl)benzonitrile. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 5g.
4-(1,1-difluoro-2-hydroxyethyl)benzonitrile (CAS 2082663-46-3) is a chemical compound with the molecular formula C9H7F2NO and a molecular weight of 183.15 g/mol. IUPAC name: 4-(1,1-difluoro-2-hydroxyethyl)benzonitrile. InChIKey: MDCDYJGJKPJFAF-UHFFFAOYSA-N.
| Molecular formula | C9H7F2NO |
|---|---|
| Molecular weight | 183.15 g/mol |
| IUPAC name | 4-(1,1-difluoro-2-hydroxyethyl)benzonitrile |
| InChIKey | MDCDYJGJKPJFAF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C(CO)(F)F |
Computed by PubChem (NCBI)