Products 956964-02-6
CAS 956964-02-6 is the registry number for 2-((3,4-Dimethylphenyl)amino)-2-oxoethyl 4-(1H-pyrazol-1-yl)benzoate, 98%, 98%. Offered by: Chemat. Available pack sizes: 5mg, 25mg, 100mg, 250mg.
[2-(3,4-dimethylanilino)-2-oxoethyl] 4-pyrazol-1-ylbenzoate (CAS 956964-02-6) is a chemical compound with the molecular formula C20H19N3O3 and a molecular weight of 349.4 g/mol. IUPAC name: [2-(3,4-dimethylanilino)-2-oxoethyl] 4-pyrazol-1-ylbenzoate. InChIKey: OMKUCFAFJIMHPI-UHFFFAOYSA-N.
| Molecular formula | C20H19N3O3 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | [2-(3,4-dimethylanilino)-2-oxoethyl] 4-pyrazol-1-ylbenzoate |
| InChIKey | OMKUCFAFJIMHPI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)COC(=O)C2=CC=C(C=C2)N3C=CC=N3)C |
Computed by PubChem (NCBI)