Products 20844-69-3
CAS 20844-69-3 appears in our catalog under these names: 5-(Trifluoromethyl)-1,3-benzoxazol-2-amine, 98%, 5-(Trifluoromethyl)benzo(d)oxazol-2-amine, 98%, 5-(Trifluoromethyl)-1,3-benzoxazol-2-amine. Offered by: Combi-blocks, AmBeed, TRC, Biosynth. Available pack sizes: 1g, 5g, 100mg, 0,5g, 50mg.
5-(trifluoromethyl)-1,3-benzoxazol-2-amine (CAS 20844-69-3) is a chemical compound with the molecular formula C8H5F3N2O and a molecular weight of 202.13 g/mol. IUPAC name: 5-(trifluoromethyl)-1,3-benzoxazol-2-amine. InChIKey: JTDXQCUQIUYDDA-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2O |
|---|---|
| Molecular weight | 202.13 g/mol |
| IUPAC name | 5-(trifluoromethyl)-1,3-benzoxazol-2-amine |
| InChIKey | JTDXQCUQIUYDDA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)N=C(O2)N |
Computed by PubChem (NCBI)