Products 2085307-49-7
CAS 2085307-49-7 is the registry number for 6-Fluoro-2-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 50mg.
6-fluoro-2-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2085307-49-7) is a chemical compound with the molecular formula C12H17BFNO3 and a molecular weight of 253.08 g/mol. IUPAC name: 6-fluoro-2-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: CJBCKFTZANUJMV-UHFFFAOYSA-N.
| Molecular formula | C12H17BFNO3 |
|---|---|
| Molecular weight | 253.08 g/mol |
| IUPAC name | 6-fluoro-2-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | CJBCKFTZANUJMV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=C(C=C2)F)OC |
Computed by PubChem (NCBI)