CAS 2085709-73-3 appears in our catalog under these names: Moxifloxacin Impurity 74, Moxifloxacin Impurity 68. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Ethyl (4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine-6-carboxylate (CAS 2085709-73-3) is a chemical compound with the molecular formula C10H18N2O2 and a molecular weight of 198.26 g/mol. IUPAC name: ethyl (4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine-6-carboxylate. InChIKey: LXLHKOWSARZMFX-DTWKUNHWSA-N.
| Molecular formula | C10H18N2O2 |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | ethyl (4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine-6-carboxylate |
| InChIKey | LXLHKOWSARZMFX-DTWKUNHWSA-N |
| SMILES | CCOC(=O)N1C[C@@H]2CCCN[C@@H]2C1 |
Computed by PubChem (NCBI)