Products 208647-48-7
CAS 208647-48-7 is the registry number for 1-Naphthyl a-D-glucopyranoside. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg.
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-naphthalen-1-yloxyoxane-3,4,5-triol (CAS 208647-48-7) is a chemical compound with the molecular formula C16H18O6 and a molecular weight of 306.31 g/mol. IUPAC name: (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-naphthalen-1-yloxyoxane-3,4,5-triol. InChIKey: CVAOQMBKGUKOIZ-LJIZCISZSA-N.
| Molecular formula | C16H18O6 |
|---|---|
| Molecular weight | 306.31 g/mol |
| IUPAC name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-naphthalen-1-yloxyoxane-3,4,5-triol |
| InChIKey | CVAOQMBKGUKOIZ-LJIZCISZSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O |
Computed by PubChem (NCBI)