CAS 212140-32-4 is the registry number for 2-Naphthyl b-D-mannopyranoside, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(hydroxymethyl)-6-naphthalen-2-yloxyoxane-3,4,5-triol (CAS 212140-32-4) is a chemical compound with the molecular formula C16H18O6 and a molecular weight of 306.31 g/mol. IUPAC name: 2-(hydroxymethyl)-6-naphthalen-2-yloxyoxane-3,4,5-triol. InChIKey: MWHKPYATGMFFPI-UHFFFAOYSA-N.
| Molecular formula | C16H18O6 |
|---|---|
| Molecular weight | 306.31 g/mol |
| IUPAC name | 2-(hydroxymethyl)-6-naphthalen-2-yloxyoxane-3,4,5-triol |
| InChIKey | MWHKPYATGMFFPI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)OC3C(C(C(C(O3)CO)O)O)O |
Computed by PubChem (NCBI)