CAS 83833-13-0 is the registry number for 1-Naphthyl-alpha-d-mannopyranoside, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-naphthalen-1-yloxyoxane-3,4,5-triol (CAS 83833-13-0) is a chemical compound with the molecular formula C16H18O6 and a molecular weight of 306.31 g/mol. IUPAC name: (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-naphthalen-1-yloxyoxane-3,4,5-triol. InChIKey: CVAOQMBKGUKOIZ-OWYFMNJBSA-N.
| Molecular formula | C16H18O6 |
|---|---|
| Molecular weight | 306.31 g/mol |
| IUPAC name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-naphthalen-1-yloxyoxane-3,4,5-triol |
| InChIKey | CVAOQMBKGUKOIZ-OWYFMNJBSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2O[C@@H]3[C@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O |
Computed by PubChem (NCBI)