Products 20876-28-2
CAS 20876-28-2 appears in our catalog under these names: 2-(2-Methoxy-6-nitrophenyl)acetic acid, 95%, 2-(2-Methoxy-6-nitrophenyl)acetic acid, 98%, 2-METHOXY-6-NITROPHENYLACETIC ACID, 98%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-(2-methoxy-6-nitrophenyl)acetic acid (CAS 20876-28-2) is a chemical compound with the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. IUPAC name: 2-(2-methoxy-6-nitrophenyl)acetic acid. InChIKey: WWZXCZMODVFKSK-UHFFFAOYSA-N.
| Molecular formula | C9H9NO5 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | 2-(2-methoxy-6-nitrophenyl)acetic acid |
| InChIKey | WWZXCZMODVFKSK-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1CC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
2-Methoxy-6-nitrophenylacetic acid, 2-(2-methoxy-6-nitrophenyl)acetic acid, Benzeneacetic acid, 2-methoxy-6-nitro-, (2-Methoxy-6-nitrophenyl)acetic acid, 2-(2-methoxy-6-nitrophenyl)aceticacid, Phenylacetic acid, 2-methoxy-6-nitro-, (2-Methoxy-6-nitrophenyl)acetic acid #, 2-(2-methoxy-6-nitro-phenyl)acetic acid