CAS 2088945-70-2 is the registry number for 6-(Trifluoromethyl)chroman-4-amine hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 2088945-70-2) is a chemical compound with the molecular formula C10H11ClF3NO and a molecular weight of 253.65 g/mol. IUPAC name: 6-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: WFTUXBCZUUVNKW-UHFFFAOYSA-N.
| Molecular formula | C10H11ClF3NO |
|---|---|
| Molecular weight | 253.65 g/mol |
| IUPAC name | 6-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | WFTUXBCZUUVNKW-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1N)C=C(C=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)