CAS 2089034-24-0 appears in our catalog under these names: 2-(tert-Butyl)-2H-benzo(e)(1,2,4)thiadiazin-3(4H)-one, 98%, 2-(tert-Butyl)-2H-benzo[e][1,2,4]thiadiazin-3(4H)-one, ≥95%, ≥95%, 2-(TERT-BUTYL)-2H-BENZO[E][1,2,4]THIADIAZIN-3(4H)-ONE, ≥95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
2-tert-butyl-4H-1,2,4-benzothiadiazin-3-one (CAS 2089034-24-0) is a chemical compound with the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. IUPAC name: 2-tert-butyl-4H-1,2,4-benzothiadiazin-3-one. InChIKey: NWKWTVLZSQNLPB-UHFFFAOYSA-N.
| Molecular formula | C11H14N2OS |
|---|---|
| Molecular weight | 222.31 g/mol |
| IUPAC name | 2-tert-butyl-4H-1,2,4-benzothiadiazin-3-one |
| InChIKey | NWKWTVLZSQNLPB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C(=O)NC2=CC=CC=C2S1 |
Computed by PubChem (NCBI)