CAS 208925-08-0 appears in our catalog under these names: Vilanterol Impurity 36, (R)-2-Amino-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)ethanol, (R)-2-Amino-1-(2,2-dimethyl-4H-benzo[d][1,3]dioxin-6-yl)ethan-1-ol, 95%, 95%. Offered by: Hubei YoungXin, TRC, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg, 5mg, 250mg.
(1R)-2-amino-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)ethanol (CAS 208925-08-0) is a chemical compound with the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. IUPAC name: (1R)-2-amino-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)ethanol. InChIKey: XTAAANMPVNIYBF-JTQLQIEISA-N.
| Molecular formula | C12H17NO3 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | (1R)-2-amino-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)ethanol |
| InChIKey | XTAAANMPVNIYBF-JTQLQIEISA-N |
| SMILES | CC1(OCC2=C(O1)C=CC(=C2)[C@H](CN)O)C |
Computed by PubChem (NCBI)