Products 2089289-04-1
CAS 2089289-04-1 is the registry number for Methyl 2-Fluoro-5-(1-methyl-5-pyrazolyl)benzoate, ≥97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 2-fluoro-5-(2-methylpyrazol-3-yl)benzoate (CAS 2089289-04-1) is a chemical compound with the molecular formula C12H11FN2O2 and a molecular weight of 234.23 g/mol. IUPAC name: methyl 2-fluoro-5-(2-methylpyrazol-3-yl)benzoate. InChIKey: IAILIHYVUISFPW-UHFFFAOYSA-N.
| Molecular formula | C12H11FN2O2 |
|---|---|
| Molecular weight | 234.23 g/mol |
| IUPAC name | methyl 2-fluoro-5-(2-methylpyrazol-3-yl)benzoate |
| InChIKey | IAILIHYVUISFPW-UHFFFAOYSA-N |
| SMILES | CN1C(=CC=N1)C2=CC(=C(C=C2)F)C(=O)OC |
Computed by PubChem (NCBI)