Products 2089324-41-2
CAS 2089324-41-2 is the registry number for Methyl 3-(3-Aminophenyl)cyclobutanecarboxylate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 3-(3-aminophenyl)cyclobutane-1-carboxylate (CAS 2089324-41-2) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: methyl 3-(3-aminophenyl)cyclobutane-1-carboxylate. InChIKey: OHXDEMKQPKRDCS-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | methyl 3-(3-aminophenyl)cyclobutane-1-carboxylate |
| InChIKey | OHXDEMKQPKRDCS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC(C1)C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)