CAS 208940-81-2 is the registry number for 2-Formyl-3,5-dimethoxybenzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-formyl-3,5-dimethoxybenzoic acid (CAS 208940-81-2) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: 2-formyl-3,5-dimethoxybenzoic acid. InChIKey: DVSDHDVOODKXPU-UHFFFAOYSA-N.
| Molecular formula | C10H10O5 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | 2-formyl-3,5-dimethoxybenzoic acid |
| InChIKey | DVSDHDVOODKXPU-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)C=O)C(=O)O |
Computed by PubChem (NCBI)