CAS 208944-55-2 is the registry number for Methyl 3-amino-5-(4-isobutylphenyl)thiophene-2-carboxylate, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-amino-5-[4-(2-methylpropyl)phenyl]thiophene-2-carboxylate (CAS 208944-55-2) is a chemical compound with the molecular formula C16H19NO2S and a molecular weight of 289.4 g/mol. IUPAC name: methyl 3-amino-5-[4-(2-methylpropyl)phenyl]thiophene-2-carboxylate. InChIKey: CYBUSLWBHVFSJH-UHFFFAOYSA-N.
| Molecular formula | C16H19NO2S |
|---|---|
| Molecular weight | 289.4 g/mol |
| IUPAC name | methyl 3-amino-5-[4-(2-methylpropyl)phenyl]thiophene-2-carboxylate |
| InChIKey | CYBUSLWBHVFSJH-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CC=C(C=C1)C2=CC(=C(S2)C(=O)OC)N |
Computed by PubChem (NCBI)