Products 4703-17-7
CAS 4703-17-7 is the registry number for 4-methyl-N-(2,4,6-trimethylphenyl)benzenesulfonamide, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g.
4-methyl-N-(2,4,6-trimethylphenyl)benzenesulfonamide (CAS 4703-17-7) is a chemical compound with the molecular formula C16H19NO2S and a molecular weight of 289.4 g/mol. IUPAC name: 4-methyl-N-(2,4,6-trimethylphenyl)benzenesulfonamide. InChIKey: ANVUKJDKJYJFNE-UHFFFAOYSA-N.
| Molecular formula | C16H19NO2S |
|---|---|
| Molecular weight | 289.4 g/mol |
| IUPAC name | 4-methyl-N-(2,4,6-trimethylphenyl)benzenesulfonamide |
| InChIKey | ANVUKJDKJYJFNE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=C(C=C(C=C2C)C)C |
Computed by PubChem (NCBI)