CAS 350989-95-6 appears in our catalog under these names: Methyl 2-amino-4-(4-tert-butylphenyl)thiophene-3-carboxylate, 95%, 2-Amino-4-(4-tert-butylphenyl)thiophene-3-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
Methyl 2-amino-4-(4-tert-butylphenyl)thiophene-3-carboxylate (CAS 350989-95-6) is a chemical compound with the molecular formula C16H19NO2S and a molecular weight of 289.4 g/mol. IUPAC name: methyl 2-amino-4-(4-tert-butylphenyl)thiophene-3-carboxylate. InChIKey: VJJSQHYNOYFKHX-UHFFFAOYSA-N.
| Molecular formula | C16H19NO2S |
|---|---|
| Molecular weight | 289.4 g/mol |
| IUPAC name | methyl 2-amino-4-(4-tert-butylphenyl)thiophene-3-carboxylate |
| InChIKey | VJJSQHYNOYFKHX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=CSC(=C2C(=O)OC)N |
Computed by PubChem (NCBI)