Products 2089575-84-6
CAS 2089575-84-6 is the registry number for 4-TM.P. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-yl] pyrazine-2-carboxylate (CAS 2089575-84-6) is a chemical compound with the molecular formula C18H24N2O2 and a molecular weight of 300.4 g/mol. IUPAC name: [(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-yl] pyrazine-2-carboxylate. InChIKey: ZPOOCMNYTIUCJL-BQYQJAHWSA-N.
| Molecular formula | C18H24N2O2 |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | [(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-yl] pyrazine-2-carboxylate |
| InChIKey | ZPOOCMNYTIUCJL-BQYQJAHWSA-N |
| SMILES | CC1=C(C(CCC1)(C)C)/C=C/C(C)OC(=O)C2=NC=CN=C2 |
Computed by PubChem (NCBI)