Products 2089913-52-8
CAS 2089913-52-8 appears in our catalog under these names: 7-Bromo-3-chloroquinoline-2-carboxylic acid, 95%, 95%, 7-Bromo-3-chloroquinoline-2-carboxylic acid, 95%. Offered by: Chemat, Ambeed, BLDpharm. Available pack sizes: 1g, 250mg, 100mg.
7-bromo-3-chloroquinoline-2-carboxylic acid (CAS 2089913-52-8) is a chemical compound with the molecular formula C10H5BrClNO2 and a molecular weight of 286.51 g/mol. IUPAC name: 7-bromo-3-chloroquinoline-2-carboxylic acid. InChIKey: UFADHTRTSWNNRW-UHFFFAOYSA-N.
| Molecular formula | C10H5BrClNO2 |
|---|---|
| Molecular weight | 286.51 g/mol |
| IUPAC name | 7-bromo-3-chloroquinoline-2-carboxylic acid |
| InChIKey | UFADHTRTSWNNRW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=NC(=C(C=C21)Cl)C(=O)O)Br |
Computed by PubChem (NCBI)