CAS 2090536-09-5 is the registry number for 2-Bromo-1-(difluoromethyl)-3,4-dimethoxybenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-1-(difluoromethyl)-3,4-dimethoxybenzene (CAS 2090536-09-5) is a chemical compound with the molecular formula C9H9BrF2O2 and a molecular weight of 267.07 g/mol. IUPAC name: 2-bromo-1-(difluoromethyl)-3,4-dimethoxybenzene. InChIKey: GMKRJMYZLZFWIU-UHFFFAOYSA-N.
| Molecular formula | C9H9BrF2O2 |
|---|---|
| Molecular weight | 267.07 g/mol |
| IUPAC name | 2-bromo-1-(difluoromethyl)-3,4-dimethoxybenzene |
| InChIKey | GMKRJMYZLZFWIU-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C(F)F)Br)OC |
Computed by PubChem (NCBI)