CAS 2092617-16-6 is the registry number for 1-Bromo-2-(difluoromethyl)-3,5-dimethoxybenzene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-2-(difluoromethyl)-3,5-dimethoxybenzene (CAS 2092617-16-6) is a chemical compound with the molecular formula C9H9BrF2O2 and a molecular weight of 267.07 g/mol. IUPAC name: 1-bromo-2-(difluoromethyl)-3,5-dimethoxybenzene. InChIKey: YFDRKPJHTKDHOS-UHFFFAOYSA-N.
| Molecular formula | C9H9BrF2O2 |
|---|---|
| Molecular weight | 267.07 g/mol |
| IUPAC name | 1-bromo-2-(difluoromethyl)-3,5-dimethoxybenzene |
| InChIKey | YFDRKPJHTKDHOS-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)Br)C(F)F)OC |
Computed by PubChem (NCBI)