Products 2228656-15-1
CAS 2228656-15-1 appears in our catalog under these names: 2–(4–bromo–3–methoxyphenyl)–2，2–difluoroethan–1–ol, 2-(4-bromo-3-methoxyphenyl)-2，2-difluoroethan-1-ol. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg.
2-(4-bromo-3-methoxyphenyl)-2,2-difluoroethanol (CAS 2228656-15-1) is a chemical compound with the molecular formula C9H9BrF2O2 and a molecular weight of 267.07 g/mol. IUPAC name: 2-(4-bromo-3-methoxyphenyl)-2,2-difluoroethanol. InChIKey: RPRMXBVXBFQTQX-UHFFFAOYSA-N.
| Molecular formula | C9H9BrF2O2 |
|---|---|
| Molecular weight | 267.07 g/mol |
| IUPAC name | 2-(4-bromo-3-methoxyphenyl)-2,2-difluoroethanol |
| InChIKey | RPRMXBVXBFQTQX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(CO)(F)F)Br |
Computed by PubChem (NCBI)