CAS 2090556-93-5 is the registry number for 5-Bromo-2-fluoro-3-methoxybenzamide, 98%. Offered by: AmBeed. Available pack sizes: 10g, 5g, 1g.
5-bromo-2-fluoro-3-methoxybenzamide (CAS 2090556-93-5) is a chemical compound with the molecular formula C8H7BrFNO2 and a molecular weight of 248.05 g/mol. IUPAC name: 5-bromo-2-fluoro-3-methoxybenzamide. InChIKey: MYCVDEXWHLLMAK-UHFFFAOYSA-N.
| Molecular formula | C8H7BrFNO2 |
|---|---|
| Molecular weight | 248.05 g/mol |
| IUPAC name | 5-bromo-2-fluoro-3-methoxybenzamide |
| InChIKey | MYCVDEXWHLLMAK-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1F)C(=O)N)Br |
Computed by PubChem (NCBI)