Products 2090757-52-9
CAS 2090757-52-9 is the registry number for tert-Butyl 3-amino-2-chloro-6-fluorobenzoate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Tert-butyl 3-amino-2-chloro-6-fluorobenzoate (CAS 2090757-52-9) is a chemical compound with the molecular formula C11H13ClFNO2 and a molecular weight of 245.68 g/mol. IUPAC name: tert-butyl 3-amino-2-chloro-6-fluorobenzoate. InChIKey: MBKHQZJYXOHDGK-UHFFFAOYSA-N.
| Molecular formula | C11H13ClFNO2 |
|---|---|
| Molecular weight | 245.68 g/mol |
| IUPAC name | tert-butyl 3-amino-2-chloro-6-fluorobenzoate |
| InChIKey | MBKHQZJYXOHDGK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=CC(=C1Cl)N)F |
Computed by PubChem (NCBI)