CAS 2090914-30-8 is the registry number for Ethyl 5-Bromo-6-methylpyrazine-2-carboxylate. Offered by: TRC. Available pack sizes: 1g.
Ethyl 5-bromo-6-methylpyrazine-2-carboxylate (CAS 2090914-30-8) is a chemical compound with the molecular formula C8H9BrN2O2 and a molecular weight of 245.07 g/mol. IUPAC name: ethyl 5-bromo-6-methylpyrazine-2-carboxylate. InChIKey: MLOIVEBQSQXNSH-UHFFFAOYSA-N.
| Molecular formula | C8H9BrN2O2 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | ethyl 5-bromo-6-methylpyrazine-2-carboxylate |
| InChIKey | MLOIVEBQSQXNSH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(C(=N1)C)Br |
Computed by PubChem (NCBI)