CAS 2090967-71-6 is the registry number for 1-({1-((tert-Butoxy)carbonyl)azetidin-3-yl}methyl)-1H-1,2,3-triazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-[[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]methyl]triazole-4-carboxylic acid (CAS 2090967-71-6) is a chemical compound with the molecular formula C12H18N4O4 and a molecular weight of 282.30 g/mol. IUPAC name: 1-[[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]methyl]triazole-4-carboxylic acid. InChIKey: WQIBRWQZVJPEHG-UHFFFAOYSA-N.
| Molecular formula | C12H18N4O4 |
|---|---|
| Molecular weight | 282.30 g/mol |
| IUPAC name | 1-[[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]methyl]triazole-4-carboxylic acid |
| InChIKey | WQIBRWQZVJPEHG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)CN2C=C(N=N2)C(=O)O |
Computed by PubChem (NCBI)