Products 2576471-56-0
CAS 2576471-56-0 appears in our catalog under these names: 8-Azido-octanoyl-OSu, 8-Azido-octanoyl-OSu, 95%. Offered by: Iris Biotech, MedChemExpress, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g, Get quote.
(2,5-dioxopyrrolidin-1-yl) 8-azidooctanoate (CAS 2576471-56-0) is a chemical compound with the molecular formula C12H18N4O4 and a molecular weight of 282.30 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 8-azidooctanoate. InChIKey: XHGZLUIWAPDNRV-UHFFFAOYSA-N.
| Molecular formula | C12H18N4O4 |
|---|---|
| Molecular weight | 282.30 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 8-azidooctanoate |
| InChIKey | XHGZLUIWAPDNRV-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCCCCCCN=[N+]=[N-] |
Computed by PubChem (NCBI)