Products 21416-68-2
CAS 21416-68-2 appears in our catalog under these names: ICRF-193, ICRF-196. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, Get quote.
4-[3-(3,5-dioxopiperazin-1-yl)butan-2-yl]piperazine-2,6-dione (CAS 21416-68-2) is a chemical compound with the molecular formula C12H18N4O4 and a molecular weight of 282.30 g/mol. IUPAC name: 4-[3-(3,5-dioxopiperazin-1-yl)butan-2-yl]piperazine-2,6-dione. InChIKey: OBYGAPWKTPDTAS-UHFFFAOYSA-N.
| Molecular formula | C12H18N4O4 |
|---|---|
| Molecular weight | 282.30 g/mol |
| IUPAC name | 4-[3-(3,5-dioxopiperazin-1-yl)butan-2-yl]piperazine-2,6-dione |
| InChIKey | OBYGAPWKTPDTAS-UHFFFAOYSA-N |
| SMILES | CC(C(C)N1CC(=O)NC(=O)C1)N2CC(=O)NC(=O)C2 |
Computed by PubChem (NCBI)