Products 2090980-65-5
CAS 2090980-65-5 is the registry number for (S)-5-Bromo-7-chlorochromane-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-5-bromo-7-chloro-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 2090980-65-5) is a chemical compound with the molecular formula C10H8BrClO3 and a molecular weight of 291.52 g/mol. IUPAC name: (3S)-5-bromo-7-chloro-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: PISVHWIQVBWBIS-YFKPBYRVSA-N.
| Molecular formula | C10H8BrClO3 |
|---|---|
| Molecular weight | 291.52 g/mol |
| IUPAC name | (3S)-5-bromo-7-chloro-3,4-dihydro-2H-chromene-3-carboxylic acid |
| InChIKey | PISVHWIQVBWBIS-YFKPBYRVSA-N |
| SMILES | C1[C@@H](COC2=C1C(=CC(=C2)Cl)Br)C(=O)O |
Computed by PubChem (NCBI)