Products 35158-39-5
CAS 35158-39-5 appears in our catalog under these names: 3-Bromo-4-(4-chloro-phenyl)-4-oxo-butyric acid, 95%, 3-Bromo-4-(4-chlorophenyl)-4-oxobutanoic acid, 95%, Benzobrom. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g, 2g.
3-bromo-4-(4-chlorophenyl)-4-oxobutanoic acid (CAS 35158-39-5) is a chemical compound with the molecular formula C10H8BrClO3 and a molecular weight of 291.52 g/mol. IUPAC name: 3-bromo-4-(4-chlorophenyl)-4-oxobutanoic acid. InChIKey: IGOYRYSKKLREIH-UHFFFAOYSA-N.
| Molecular formula | C10H8BrClO3 |
|---|---|
| Molecular weight | 291.52 g/mol |
| IUPAC name | 3-bromo-4-(4-chlorophenyl)-4-oxobutanoic acid |
| InChIKey | IGOYRYSKKLREIH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(CC(=O)O)Br)Cl |
Computed by PubChem (NCBI)
Synonyms:
3-Bromo-3-(4-chlorobenzoyl)propionic acid, beta-Bromo-4-chloro-gamma-oxobenzenebutanoic acid, 3-bromo-4-(4-chlorophenyl)-4-oxobutanoic acid, 3-Bromo-4-(4-chloro-phenyl)-4-oxo-butyric acid, BENZOBROM, 3-bromo-3-(p-chlorobenzoyl)propionic acid, 3-bromo-3-(p-chlorobenzoyl) propionic acid, 3-bromo-4-(4-chlorophenyl)-4-oxo-butanoic acid, Benzenebutanoic acid, beta-bromo-4-chloro-gamma-oxo-