Products 518023-87-5
CAS 518023-87-5 is the registry number for (2E)-3-(5-Bromo-3-chloro-2-methoxyphenyl)acrylic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(E)-3-(5-bromo-3-chloro-2-methoxyphenyl)prop-2-enoic acid (CAS 518023-87-5) is a chemical compound with the molecular formula C10H8BrClO3 and a molecular weight of 291.52 g/mol. IUPAC name: (E)-3-(5-bromo-3-chloro-2-methoxyphenyl)prop-2-enoic acid. InChIKey: GMXRDEQHWGMZRY-NSCUHMNNSA-N.
| Molecular formula | C10H8BrClO3 |
|---|---|
| Molecular weight | 291.52 g/mol |
| IUPAC name | (E)-3-(5-bromo-3-chloro-2-methoxyphenyl)prop-2-enoic acid |
| InChIKey | GMXRDEQHWGMZRY-NSCUHMNNSA-N |
| SMILES | COC1=C(C=C(C=C1Cl)Br)/C=C/C(=O)O |
Computed by PubChem (NCBI)