Products 2090993-34-1
CAS 2090993-34-1 is the registry number for 2-(5-Bromopyrazolo[1,5-a]pyridin-3-yl)acetonitrile, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-(5-bromopyrazolo[1,5-a]pyridin-3-yl)acetonitrile (CAS 2090993-34-1) is a chemical compound with the molecular formula C9H6BrN3 and a molecular weight of 236.07 g/mol. IUPAC name: 2-(5-bromopyrazolo[1,5-a]pyridin-3-yl)acetonitrile. InChIKey: HFLBBGJKDIGHRN-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN3 |
|---|---|
| Molecular weight | 236.07 g/mol |
| IUPAC name | 2-(5-bromopyrazolo[1,5-a]pyridin-3-yl)acetonitrile |
| InChIKey | HFLBBGJKDIGHRN-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C(C=N2)CC#N)C=C1Br |
Computed by PubChem (NCBI)