CAS 2091265-70-0 is the registry number for Methyl 5-amino-2-methylbenzo[d]thiazole-6-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-amino-2-methyl-1,3-benzothiazole-6-carboxylate (CAS 2091265-70-0) is a chemical compound with the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. IUPAC name: methyl 5-amino-2-methyl-1,3-benzothiazole-6-carboxylate. InChIKey: HWBNDJIFRNVJMA-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2S |
|---|---|
| Molecular weight | 222.27 g/mol |
| IUPAC name | methyl 5-amino-2-methyl-1,3-benzothiazole-6-carboxylate |
| InChIKey | HWBNDJIFRNVJMA-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C=C(C(=C2)N)C(=O)OC |
Computed by PubChem (NCBI)