Products 2091478-09-8
CAS 2091478-09-8 is the registry number for Methyl 4-bromo-1-(1-methylcyclopropyl)-1H-pyrazole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-bromo-1-(1-methylcyclopropyl)pyrazole-5-carboxylate (CAS 2091478-09-8) is a chemical compound with the molecular formula C9H11BrN2O2 and a molecular weight of 259.10 g/mol. IUPAC name: methyl 4-bromo-1-(1-methylcyclopropyl)pyrazole-5-carboxylate. InChIKey: DCQPDGRYFJGHOX-UHFFFAOYSA-N.
| Molecular formula | C9H11BrN2O2 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | methyl 4-bromo-1-(1-methylcyclopropyl)pyrazole-5-carboxylate |
| InChIKey | DCQPDGRYFJGHOX-UHFFFAOYSA-N |
| SMILES | CC1(CC1)N2C(=C(C=N2)Br)C(=O)OC |
Computed by PubChem (NCBI)