CAS 2091515-17-0 is the registry number for 3,6-Dibromo-2-nitrobenzenamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3,6-dibromo-2-nitroaniline (CAS 2091515-17-0) is a chemical compound with the molecular formula C6H4Br2N2O2 and a molecular weight of 295.92 g/mol. IUPAC name: 3,6-dibromo-2-nitroaniline. InChIKey: XAEQTRKMCYIWRO-UHFFFAOYSA-N.
| Molecular formula | C6H4Br2N2O2 |
|---|---|
| Molecular weight | 295.92 g/mol |
| IUPAC name | 3,6-dibromo-2-nitroaniline |
| InChIKey | XAEQTRKMCYIWRO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Br)N)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)