CAS 947534-69-2 appears in our catalog under these names: 2,5-Dibromo-4-methyl-3-nitropyridine, 98%, 2,5–Dibromo–4–methyl–3–nitropyridine, 2,5-Dibromo-4-methyl-3-nitropyridine 98%, 2,5-Dibromo-4-methyl-3-nitropyridine, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g, 100mg, 10g.
2,5-dibromo-4-methyl-3-nitropyridine (CAS 947534-69-2) is a chemical compound with the molecular formula C6H4Br2N2O2 and a molecular weight of 295.92 g/mol. IUPAC name: 2,5-dibromo-4-methyl-3-nitropyridine. InChIKey: MFWWZPPJIRAWSL-UHFFFAOYSA-N.
| Molecular formula | C6H4Br2N2O2 |
|---|---|
| Molecular weight | 295.92 g/mol |
| IUPAC name | 2,5-dibromo-4-methyl-3-nitropyridine |
| InChIKey | MFWWZPPJIRAWSL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC=C1Br)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)