CAS 75293-97-9 is the registry number for 4,5-Dibromo-2-nitroaniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,5-dibromo-2-nitroaniline (CAS 75293-97-9) is a chemical compound with the molecular formula C6H4Br2N2O2 and a molecular weight of 295.92 g/mol. IUPAC name: 4,5-dibromo-2-nitroaniline. InChIKey: QIDSVLUIWDDFKL-UHFFFAOYSA-N.
| Molecular formula | C6H4Br2N2O2 |
|---|---|
| Molecular weight | 295.92 g/mol |
| IUPAC name | 4,5-dibromo-2-nitroaniline |
| InChIKey | QIDSVLUIWDDFKL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)Br)[N+](=O)[O-])N |
Computed by PubChem (NCBI)