CAS 827-94-1 appears in our catalog under these names: 2,6-Dibromo-4-nitroaniline, 98%, 2,6-Dibromo-4-nitroaniline, 2,6–Dibromo–4–nitroaniline, 2,6-Dibromo-4-nitroaniline, >98.0%(GC), 2,6-Dibromo-4-nitroaniline 98%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Ambeed. Available pack sizes: 100g, 500g, 1kg, 25g, 5g, 1g, 2,5g, 500mg.
2,6-dibromo-4-nitroaniline (CAS 827-94-1) is a chemical compound with the molecular formula C6H4Br2N2O2 and a molecular weight of 295.92 g/mol. IUPAC name: 2,6-dibromo-4-nitroaniline. InChIKey: YMZIFDLWYUSZCC-UHFFFAOYSA-N.
| Molecular formula | C6H4Br2N2O2 |
|---|---|
| Molecular weight | 295.92 g/mol |
| IUPAC name | 2,6-dibromo-4-nitroaniline |
| InChIKey | YMZIFDLWYUSZCC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)N)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)