CAS 2091679-00-2 is the registry number for 4-Chloro-N-ethyl-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-N-ethyl-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide (CAS 2091679-00-2) is a chemical compound with the molecular formula C10H11ClN4O and a molecular weight of 238.67 g/mol. IUPAC name: 4-chloro-N-ethyl-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide. InChIKey: VYFFJAHMGQQERO-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN4O |
|---|---|
| Molecular weight | 238.67 g/mol |
| IUPAC name | 4-chloro-N-ethyl-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide |
| InChIKey | VYFFJAHMGQQERO-UHFFFAOYSA-N |
| SMILES | CCNC(=O)C1=CN2C(=C1C)C(=NC=N2)Cl |
Computed by PubChem (NCBI)