CAS 2611563-27-8 appears in our catalog under these names: 6-chloro-1-tetrahydropyran-2-yl-pyrazolo[3,4-b]pyrazine, 97%, 97%, 6-Chloro-1-tetrahydropyran-2-yl-pyrazolo[3,4-b]pyrazine, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.
6-chloro-1-(oxan-2-yl)pyrazolo[3,4-b]pyrazine (CAS 2611563-27-8) is a chemical compound with the molecular formula C10H11ClN4O and a molecular weight of 238.67 g/mol. IUPAC name: 6-chloro-1-(oxan-2-yl)pyrazolo[3,4-b]pyrazine. InChIKey: NOXKRPYMXVYWNI-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN4O |
|---|---|
| Molecular weight | 238.67 g/mol |
| IUPAC name | 6-chloro-1-(oxan-2-yl)pyrazolo[3,4-b]pyrazine |
| InChIKey | NOXKRPYMXVYWNI-UHFFFAOYSA-N |
| SMILES | C1CCOC(C1)N2C3=NC(=CN=C3C=N2)Cl |
Computed by PubChem (NCBI)