CAS 91446-15-0 appears in our catalog under these names: 4-Chloro-1-(tetrahydro-2h-pyran-2-yl)-1h-pyrazolo[3,4-d]pyrimidine, 95%, 4-Chloro-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazolo[3,4-d]pyrimidine, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
4-chloro-1-(oxan-2-yl)pyrazolo[5,4-d]pyrimidine (CAS 91446-15-0) is a chemical compound with the molecular formula C10H11ClN4O and a molecular weight of 238.67 g/mol. IUPAC name: 4-chloro-1-(oxan-2-yl)pyrazolo[5,4-d]pyrimidine. InChIKey: JVPZYGIDOLOTSM-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN4O |
|---|---|
| Molecular weight | 238.67 g/mol |
| IUPAC name | 4-chloro-1-(oxan-2-yl)pyrazolo[5,4-d]pyrimidine |
| InChIKey | JVPZYGIDOLOTSM-UHFFFAOYSA-N |
| SMILES | C1CCOC(C1)N2C3=C(C=N2)C(=NC=N3)Cl |
Computed by PubChem (NCBI)