CAS 2091686-41-6 is the registry number for Methyl 5-bromopyrrolo[2,1-f][1,2,4]triazine-7-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-bromopyrrolo[2,1-f][1,2,4]triazine-7-carboxylate (CAS 2091686-41-6) is a chemical compound with the molecular formula C8H6BrN3O2 and a molecular weight of 256.06 g/mol. IUPAC name: methyl 5-bromopyrrolo[2,1-f][1,2,4]triazine-7-carboxylate. InChIKey: FFVRAFNLPWJPCT-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3O2 |
|---|---|
| Molecular weight | 256.06 g/mol |
| IUPAC name | methyl 5-bromopyrrolo[2,1-f][1,2,4]triazine-7-carboxylate |
| InChIKey | FFVRAFNLPWJPCT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C2N1N=CN=C2)Br |
Computed by PubChem (NCBI)