Products 209173-94-4

CAS 209173-94-4 is the registry number for 3-(Quinoline-8-sulfonamido)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(quinolin-8-ylsulfonylamino)benzoic acid (CAS 209173-94-4) is a chemical compound with the molecular formula C16H12N2O4S and a molecular weight of 328.3 g/mol. IUPAC name: 3-(quinolin-8-ylsulfonylamino)benzoic acid. InChIKey: CLILVEMCMVDPJI-UHFFFAOYSA-N.

Identity
Molecular formulaC16H12N2O4S
Molecular weight328.3 g/mol
IUPAC name3-(quinolin-8-ylsulfonylamino)benzoic acid
InChIKeyCLILVEMCMVDPJI-UHFFFAOYSA-N
SMILESC1=CC2=C(C(=C1)S(=O)(=O)NC3=CC=CC(=C3)C(=O)O)N=CC=C2

Computed by PubChem (NCBI)