Products 348078-44-4

CAS 348078-44-4 is the registry number for 4-((2,4-Dioxo-3-phenyl-1,3-thiazolidin-5-yl)amino)benzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-[(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-yl)amino]benzoic acid (CAS 348078-44-4) is a chemical compound with the molecular formula C16H12N2O4S and a molecular weight of 328.3 g/mol. IUPAC name: 4-[(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-yl)amino]benzoic acid. InChIKey: LMNXIHPWMNLQSD-UHFFFAOYSA-N.

Identity
Molecular formulaC16H12N2O4S
Molecular weight328.3 g/mol
IUPAC name4-[(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-yl)amino]benzoic acid
InChIKeyLMNXIHPWMNLQSD-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)N2C(=O)C(SC2=O)NC3=CC=C(C=C3)C(=O)O

Computed by PubChem (NCBI)