CAS 419559-79-8 is the registry number for N-(1-Naphthyl)-3-nitrobenzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.
N-naphthalen-1-yl-3-nitrobenzenesulfonamide (CAS 419559-79-8) is a chemical compound with the molecular formula C16H12N2O4S and a molecular weight of 328.3 g/mol. IUPAC name: N-naphthalen-1-yl-3-nitrobenzenesulfonamide. InChIKey: WIFWFLHGNPQTSE-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O4S |
|---|---|
| Molecular weight | 328.3 g/mol |
| IUPAC name | N-naphthalen-1-yl-3-nitrobenzenesulfonamide |
| InChIKey | WIFWFLHGNPQTSE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2NS(=O)(=O)C3=CC=CC(=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)