Products 2091841-46-0
CAS 2091841-46-0 is the registry number for JMI-346. Offered by: MedChemExpress. Available pack sizes: Get quote.
[1-(4-methylphenyl)triazol-4-yl]methyl (2S)-2-amino-3-phenylpropanoate (CAS 2091841-46-0) is a chemical compound with the molecular formula C19H20N4O2 and a molecular weight of 336.4 g/mol. IUPAC name: [1-(4-methylphenyl)triazol-4-yl]methyl (2S)-2-amino-3-phenylpropanoate. InChIKey: TZQPUBNRMQNCDV-SFHVURJKSA-N.
| Molecular formula | C19H20N4O2 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | [1-(4-methylphenyl)triazol-4-yl]methyl (2S)-2-amino-3-phenylpropanoate |
| InChIKey | TZQPUBNRMQNCDV-SFHVURJKSA-N |
| SMILES | CC1=CC=C(C=C1)N2C=C(N=N2)COC(=O)[C@H](CC3=CC=CC=C3)N |
Computed by PubChem (NCBI)