Products 20920-98-3
CAS 20920-98-3 appears in our catalog under these names: 6-Methoxychroman-2-one, 95%, 6–Methoxychroman–2–one, 6-Methoxychroman-2-one 95%, 6-Methoxychroman-2-one, 95%, 95%, 6-Methoxychroman-2-one, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
6-methoxy-3,4-dihydrochromen-2-one (CAS 20920-98-3) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 6-methoxy-3,4-dihydrochromen-2-one. InChIKey: BFRVCQPRUJFVFU-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 6-methoxy-3,4-dihydrochromen-2-one |
| InChIKey | BFRVCQPRUJFVFU-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)OC(=O)CC2 |
Computed by PubChem (NCBI)