Products 2092047-08-8

CAS 2092047-08-8 appears in our catalog under these names: 2,4–Dichloro–5–fluoroquinoline, 2,4-Dichloro-5-fluoroquinoline 95%. Offered by: GLPBio, Ambeed. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2,4-dichloro-5-fluoroquinoline (CAS 2092047-08-8) is a chemical compound with the molecular formula C9H4Cl2FN and a molecular weight of 216.04 g/mol. IUPAC name: 2,4-dichloro-5-fluoroquinoline. InChIKey: KVYICSLMOSRRIQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H4Cl2FN
Molecular weight216.04 g/mol
IUPAC name2,4-dichloro-5-fluoroquinoline
InChIKeyKVYICSLMOSRRIQ-UHFFFAOYSA-N
SMILESC1=CC2=C(C(=C1)F)C(=CC(=N2)Cl)Cl

Computed by PubChem (NCBI)