CAS 2092047-08-8 appears in our catalog under these names: 2,4–Dichloro–5–fluoroquinoline, 2,4-Dichloro-5-fluoroquinoline 95%. Offered by: GLPBio, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2,4-dichloro-5-fluoroquinoline (CAS 2092047-08-8) is a chemical compound with the molecular formula C9H4Cl2FN and a molecular weight of 216.04 g/mol. IUPAC name: 2,4-dichloro-5-fluoroquinoline. InChIKey: KVYICSLMOSRRIQ-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl2FN |
|---|---|
| Molecular weight | 216.04 g/mol |
| IUPAC name | 2,4-dichloro-5-fluoroquinoline |
| InChIKey | KVYICSLMOSRRIQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)C(=CC(=N2)Cl)Cl |
Computed by PubChem (NCBI)