Products 2092230-21-0

CAS 2092230-21-0 is the registry number for Methyl 4-hydroxy-6-methyl-1H-indole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 4-hydroxy-6-methyl-1H-indole-2-carboxylate (CAS 2092230-21-0) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: methyl 4-hydroxy-6-methyl-1H-indole-2-carboxylate. InChIKey: CODYZQJZHOPLFZ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11NO3
Molecular weight205.21 g/mol
IUPAC namemethyl 4-hydroxy-6-methyl-1H-indole-2-carboxylate
InChIKeyCODYZQJZHOPLFZ-UHFFFAOYSA-N
SMILESCC1=CC2=C(C=C(N2)C(=O)OC)C(=C1)O

Computed by PubChem (NCBI)